C15H20N2OS — CID 11334881
3-(2,6-dimethylphenyl)-1-ethyl-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 11334881) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-ethyl-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(2,6-dimethylphenyl)-1-ethyl-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 11334881 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-ethyl-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=S)N(c2c(C)cccc2C)C(=O)C1(C)C |
| InChI | InChI=1S/C15H20N2OS/c1-6-16-14(19)17(13(18)15(16,4)5)12-10(2)8-7-9-11(12)3/h7-9H,6H2,1-5H3 |
| InChIKey | LODXUAMMYRIYMY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|