C23H22N2O2Si — CID 140848609
1-ethyl-3-triphenylsilylimidazolidine-2,4-dione (PubChem CID 140848609) has the molecular formula C23H22N2O2Si and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-ethyl-3-triphenylsilylimidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-triphenylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848609 |
| Molecular Formula | C23H22N2O2Si |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-ethyl-3-triphenylsilylimidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N([Si](c2ccccc2)(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H22N2O2Si/c1-2-24-18-22(26)25(23(24)27)28(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3 |
| InChIKey | RIBKCXBGRZQHII-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|