C14H16N2O2 — CID 142249740
3-benzyl-1-[(E)-but-2-enyl]imidazolidine-2,4-dione (PubChem CID 142249740) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-benzyl-1-[(E)-but-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 3-benzyl-1-[(E)-but-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142249740 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-benzyl-1-[(E)-but-2-enyl]imidazolidine-2,4-dione |
| SMILES | C/C=C/CN1CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C14H16N2O2/c1-2-3-9-15-11-13(17)16(14(15)18)10-12-7-5-4-6-8-12/h2-8H,9-11H2,1H3/b3-2+ |
| InChIKey | AYYZEYRMMUSZIK-NSCUHMNNSA-N |
| XLogP | 2.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|