C9H12N2O4 — CID 70580657
1,3-bis(3-hydroxyprop-2-enyl)imidazolidine-2,4-dione (PubChem CID 70580657) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 1,3-bis(3-hydroxyprop-2-enyl)imidazolidine-2,4-dione.
| Compound Name | 1,3-bis(3-hydroxyprop-2-enyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70580657 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,3-bis(3-hydroxyprop-2-enyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(CC=CO)C(=O)N1CC=CO |
| InChI | InChI=1S/C9H12N2O4/c12-5-1-3-10-7-8(14)11(9(10)15)4-2-6-13/h1-2,5-6,12-13H,3-4,7H2 |
| InChIKey | XPGCLFKQPGXPOE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|