C21H26N2O2Si — CID 140848596
1,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione (PubChem CID 140848596) has the molecular formula C21H26N2O2Si and a molecular weight of 366.54 g/mol. Its IUPAC name is 1,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione.
| Compound Name | 1,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848596 |
| Molecular Formula | C21H26N2O2Si |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione |
| SMILES | CC[Si](CC)(CC)N1C(=O)C(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H26N2O2Si/c1-4-26(5-2,6-3)23-20(24)19(17-13-9-7-10-14-17)22(21(23)25)18-15-11-8-12-16-18/h7-16,19H,4-6H2,1-3H3 |
| InChIKey | MPJSWCYARHOGNI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|