C21H16N2O2 — CID 154708380
(5S)-1,3,5-triphenylimidazolidine-2,4-dione (PubChem CID 154708380) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is (5S)-1,3,5-triphenylimidazolidine-2,4-dione.
| Compound Name | (5S)-1,3,5-triphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154708380 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (5S)-1,3,5-triphenylimidazolidine-2,4-dione |
| SMILES | O=C1[C@H](c2ccccc2)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H16N2O2/c24-20-19(16-10-4-1-5-11-16)22(17-12-6-2-7-13-17)21(25)23(20)18-14-8-3-9-15-18/h1-15,19H/t19-/m0/s1 |
| InChIKey | YEGAYNNVHYHYEO-IBGZPJMESA-N |
| XLogP | 4.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|