C17H13N2NaO4 — CID 141290574
sodium 2-(2,5-dioxo-3,4-diphenylimidazolidin-1-yl)acetate (PubChem CID 141290574) has the molecular formula C17H13N2NaO4 and a molecular weight of 332.29 g/mol. Its IUPAC name is sodium 2-(2,5-dioxo-3,4-diphenylimidazolidin-1-yl)acetate.
| Compound Name | sodium 2-(2,5-dioxo-3,4-diphenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 141290574 |
| Molecular Formula | C17H13N2NaO4 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | sodium 2-(2,5-dioxo-3,4-diphenylimidazolidin-1-yl)acetate |
| SMILES | O=C([O-])CN1C(=O)C(c2ccccc2)N(c2ccccc2)C1=O.[Na+] |
| InChI | InChI=1S/C17H14N2O4.Na/c20-14(21)11-18-16(22)15(12-7-3-1-4-8-12)19(17(18)23)13-9-5-2-6-10-13;/h1-10,15H,11H2,(H,20,21);/q;+1/p-1 |
| InChIKey | ISSDYFANMTZITF-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|