C17H13N2O3S- — CID 6939094
2-[(4S)-5-oxo-1,3-diphenyl-2-sulfanylideneimidazolidin-4-yl]acetate (PubChem CID 6939094) has the molecular formula C17H13N2O3S- and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[(4S)-5-oxo-1,3-diphenyl-2-sulfanylideneimidazolidin-4-yl]acetate.
| Compound Name | 2-[(4S)-5-oxo-1,3-diphenyl-2-sulfanylideneimidazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 6939094 |
| Molecular Formula | C17H13N2O3S- |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[(4S)-5-oxo-1,3-diphenyl-2-sulfanylideneimidazolidin-4-yl]acetate |
| SMILES | O=C([O-])C[C@H]1C(=O)N(c2ccccc2)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C17H14N2O3S/c20-15(21)11-14-16(22)19(13-9-5-2-6-10-13)17(23)18(14)12-7-3-1-4-8-12/h1-10,14H,11H2,(H,20,21)/p-1/t14-/m0/s1 |
| InChIKey | YUOIZOQWJILKLB-AWEZNQCLSA-M |
| XLogP | 1.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|