C25H22FN3O2S — CID 1025495
2-[(4R)-3-[2-(2-fluorophenyl)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide (PubChem CID 1025495) has the molecular formula C25H22FN3O2S and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[(4R)-3-[2-(2-fluorophenyl)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R)-3-[2-(2-fluorophenyl)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 1025495 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[(4R)-3-[2-(2-fluorophenyl)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@@H]1C(=O)N(c2ccccc2)C(=S)N1CCc1ccccc1F)Nc1ccccc1 |
| InChI | InChI=1S/C25H22FN3O2S/c26-21-14-8-7-9-18(21)15-16-28-22(17-23(30)27-19-10-3-1-4-11-19)24(31)29(25(28)32)20-12-5-2-6-13-20/h1-14,22H,15-17H2,(H,27,30)/t22-/m1/s1 |
| InChIKey | FAJUJDWPSOYSFS-JOCHJYFZSA-N |
| XLogP | 4.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|