C28H28FN3O3S — CID 41201436
2-[(4R)-1-benzyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 41201436) has the molecular formula C28H28FN3O3S and a molecular weight of 505.62 g/mol. Its IUPAC name is 2-[(4R)-1-benzyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(4R)-1-benzyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41201436 |
| Molecular Formula | C28H28FN3O3S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-[(4R)-1-benzyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)C[C@@H]2C(=O)N(Cc3ccccc3)C(=S)N2CCc2ccccc2F)cc1 |
| InChI | InChI=1S/C28H28FN3O3S/c1-2-35-23-14-12-22(13-15-23)30-26(33)18-25-27(34)32(19-20-8-4-3-5-9-20)28(36)31(25)17-16-21-10-6-7-11-24(21)29/h3-15,25H,2,16-19H2,1H3,(H,30,33)/t25-/m1/s1 |
| InChIKey | HXMXUHYKFITLCF-RUZDIDTESA-N |
| XLogP | 4.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|