C21H21F2N3O2S — CID 2950543
2-[1-ethyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 2950543) has the molecular formula C21H21F2N3O2S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[1-ethyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1-ethyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2950543 |
| Molecular Formula | C21H21F2N3O2S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[1-ethyl-3-[2-(2-fluorophenyl)ethyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(F)cc2)N(CCc2ccccc2F)C1=S |
| InChI | InChI=1S/C21H21F2N3O2S/c1-2-25-20(28)18(13-19(27)24-16-9-7-15(22)8-10-16)26(21(25)29)12-11-14-5-3-4-6-17(14)23/h3-10,18H,2,11-13H2,1H3,(H,24,27) |
| InChIKey | COEHMCVTALJOFL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|