C21H22FN3O2S — CID 7025975
2-[(4S)-1-ethyl-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 7025975) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[(4S)-1-ethyl-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(4S)-1-ethyl-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7025975 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[(4S)-1-ethyl-5-oxo-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN1C(=O)[C@H](CC(=O)Nc2ccc(F)cc2)N(CCc2ccccc2)C1=S |
| InChI | InChI=1S/C21H22FN3O2S/c1-2-24-20(27)18(14-19(26)23-17-10-8-16(22)9-11-17)25(21(24)28)13-12-15-6-4-3-5-7-15/h3-11,18H,2,12-14H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | ARERQMHLPAMGBF-SFHVURJKSA-N |
| XLogP | 3.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|