C29H29N3O4S — CID 40971822
methyl 4-[[2-[(4R)-5-oxo-1,3-bis(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 40971822) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-5-oxo-1,3-bis(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4R)-5-oxo-1,3-bis(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 40971822 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | methyl 4-[[2-[(4R)-5-oxo-1,3-bis(2-phenylethyl)-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C[C@@H]2C(=O)N(CCc3ccccc3)C(=S)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N3O4S/c1-36-28(35)23-12-14-24(15-13-23)30-26(33)20-25-27(34)32(19-17-22-10-6-3-7-11-22)29(37)31(25)18-16-21-8-4-2-5-9-21/h2-15,25H,16-20H2,1H3,(H,30,33)/t25-/m1/s1 |
| InChIKey | YQZGSQGNWXVMNR-RUZDIDTESA-N |
| XLogP | 4.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|