C19H18N2O4 — CID 39026900
(5S)-3-[2-(2-methoxyphenyl)-2-oxoethyl]-5-methyl-1-phenylimidazolidine-2,4-dione (PubChem CID 39026900) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (5S)-3-[2-(2-methoxyphenyl)-2-oxoethyl]-5-methyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2-methoxyphenyl)-2-oxoethyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39026900 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (5S)-3-[2-(2-methoxyphenyl)-2-oxoethyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1C(=O)CN1C(=O)[C@H](C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18N2O4/c1-13-18(23)20(19(24)21(13)14-8-4-3-5-9-14)12-16(22)15-10-6-7-11-17(15)25-2/h3-11,13H,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | PZEYLBJHHVQJNH-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|