C17H21N3O3 — CID 39537413
N-cyclopropyl-N-ethyl-2-[(4R)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide (PubChem CID 39537413) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2-[(4R)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-N-ethyl-2-[(4R)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 39537413 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2-[(4R)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide |
| SMILES | CCN(C(=O)CN1C(=O)[C@@H](C)N(c2ccccc2)C1=O)C1CC1 |
| InChI | InChI=1S/C17H21N3O3/c1-3-18(13-9-10-13)15(21)11-19-16(22)12(2)20(17(19)23)14-7-5-4-6-8-14/h4-8,12-13H,3,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | STUIMEDAYRHYMN-GFCCVEGCSA-N |
| XLogP | 1.85 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|