C24H27N3O5S — CID 47004330
N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-[4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 47004330) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-[4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-[4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 47004330 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-benzyl-N-(1,1-dioxothiolan-3-yl)-2-[4-methyl-3-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)N(CC(=O)N(Cc3ccccc3)C3CCS(=O)(=O)C3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-17-8-10-20(11-9-17)27-18(2)23(29)26(24(27)30)15-22(28)25(14-19-6-4-3-5-7-19)21-12-13-33(31,32)16-21/h3-11,18,21H,12-16H2,1-2H3 |
| InChIKey | PFROGPDJAFHEQE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|