C16H24N2O2Si — CID 140848595
5-methyl-1-phenyl-3-triethylsilylimidazolidine-2,4-dione (PubChem CID 140848595) has the molecular formula C16H24N2O2Si and a molecular weight of 304.47 g/mol. Its IUPAC name is 5-methyl-1-phenyl-3-triethylsilylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-1-phenyl-3-triethylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848595 |
| Molecular Formula | C16H24N2O2Si |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 5-methyl-1-phenyl-3-triethylsilylimidazolidine-2,4-dione |
| SMILES | CC[Si](CC)(CC)N1C(=O)C(C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H24N2O2Si/c1-5-21(6-2,7-3)18-15(19)13(4)17(16(18)20)14-11-9-8-10-12-14/h8-13H,5-7H2,1-4H3 |
| InChIKey | AQLDXNXTLDCJGL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|