C20H16FN3O3 — CID 17494209
3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione (PubChem CID 17494209) has the molecular formula C20H16FN3O3 and a molecular weight of 365.36 g/mol. Its IUPAC name is 3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17494209 |
| Molecular Formula | C20H16FN3O3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
| SMILES | CC1C(=O)N(Cc2ncc(-c3ccc(F)cc3)o2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H16FN3O3/c1-13-19(25)23(20(26)24(13)16-5-3-2-4-6-16)12-18-22-11-17(27-18)14-7-9-15(21)10-8-14/h2-11,13H,12H2,1H3 |
| InChIKey | QJDAMXHNSLHLKI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|