C15H14ClFN4O2 — CID 78815317
3-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 78815317) has the molecular formula C15H14ClFN4O2 and a molecular weight of 336.75 g/mol. Its IUPAC name is 3-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78815317 |
| Molecular Formula | C15H14ClFN4O2 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1C(=O)N(Cc2ncc(Cl)n2C)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14ClFN4O2/c1-9-14(22)20(8-13-18-7-12(16)19(13)2)15(23)21(9)11-5-3-10(17)4-6-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | MDWQAPNLFNJKOW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|