C20H15ClFN3O3 — CID 51250110
3-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 51250110) has the molecular formula C20H15ClFN3O3 and a molecular weight of 399.81 g/mol. Its IUPAC name is 3-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51250110 |
| Molecular Formula | C20H15ClFN3O3 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(Cc2ncc(-c3ccc(Cl)cc3)o2)C1=O |
| InChI | InChI=1S/C20H15ClFN3O3/c1-20(13-4-8-15(22)9-5-13)18(26)25(19(27)24-20)11-17-23-10-16(28-17)12-2-6-14(21)7-3-12/h2-10H,11H2,1H3,(H,24,27) |
| InChIKey | XWHQXSZBUOASNW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|