C23H22ClN3O3 — CID 46568858
3-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 46568858) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46568858 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C2(C)NC(=O)N(Cc3ncc(-c4cccc(Cl)c4)o3)C2=O)cc1 |
| InChI | InChI=1S/C23H22ClN3O3/c1-14(2)15-7-9-17(10-8-15)23(3)21(28)27(22(29)26-23)13-20-25-12-19(30-20)16-5-4-6-18(24)11-16/h4-12,14H,13H2,1-3H3,(H,26,29) |
| InChIKey | SCLWAJYAPWUTKH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|