C16H14FN3O3S — CID 94176311
(5R)-3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 94176311) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is (5R)-3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R)-3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 94176311 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (5R)-3-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N[C@]2(CCSC2)C(=O)N1Cc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H14FN3O3S/c17-11-3-1-10(2-4-11)12-7-18-13(23-12)8-20-14(21)16(19-15(20)22)5-6-24-9-16/h1-4,7H,5-6,8-9H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | YQSIDVXTCKINIP-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|