About 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde
2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde (PubChem CID 79942303) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde |
| PubChem CID | 79942303 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde |
| SMILES | CCN1CC(=O)N(CC=O)CC1=O |
| InChI | InChI=1S/C8H12N2O3/c1-2-9-5-8(13)10(3-4-11)6-7(9)12/h4H,2-3,5-6H2,1H3 |
| InChIKey | VSWWZOXULJGEQQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde?
The IUPAC name of 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde (CID 79942303) is 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde.
What is the SMILES notation for 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde?
The canonical SMILES for 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde is CCN1CC(=O)N(CC=O)CC1=O.
What is the InChIKey of 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde?
The InChIKey is VSWWZOXULJGEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-2-9-5-8(13)10(3-4-11)6-7(9)12/h4H,2-3,5-6H2,1H3.
What are the key properties of 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde?
2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde has a molecular weight of 184.19 g/mol, XLogP of -1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-2,5-dioxopiperazin-1-yl)acetaldehyde is sourced from PubChem (CID 79942303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).