C8H14N2O4 — CID 174888104
ethyl propanoate;imidazolidine-2,4-dione (PubChem CID 174888104) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is ethyl propanoate;imidazolidine-2,4-dione.
| Compound Name | ethyl propanoate;imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174888104 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | ethyl propanoate;imidazolidine-2,4-dione |
| SMILES | CCOC(=O)CC.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C5H10O2.C3H4N2O2/c1-3-5(6)7-4-2;6-2-1-4-3(7)5-2/h3-4H2,1-2H3;1H2,(H2,4,5,6,7) |
| InChIKey | SSPGJHDBFKVWMH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|