C33H54O2 — CID 70136776
4,5-dicyclohexyl-2-[(5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-1,3-dioxolane (PubChem CID 70136776) has the molecular formula C33H54O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is 4,5-dicyclohexyl-2-[(5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-1,3-dioxolane.
| Compound Name | 4,5-dicyclohexyl-2-[(5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 70136776 |
| Molecular Formula | C33H54O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 4,5-dicyclohexyl-2-[(5E,9E)-6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl]-1,3-dioxolane |
| SMILES | C=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1OC(C2CCCCC2)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C33H54O2/c1-25(2)15-12-16-26(3)17-13-18-27(4)19-14-20-28(5)33-34-31(29-21-8-6-9-22-29)32(35-33)30-23-10-7-11-24-30/h15,17,19,29-33H,5-14,16,18,20-24H2,1-4H3/b26-17+,27-19+ |
| InChIKey | RQDOLYAUYUZSJZ-QRFHUDMDSA-N |
| XLogP | 10.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|