C23H34O8 — CID 70265372
[5-carboxyoxy-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate (PubChem CID 70265372) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [5-carboxyoxy-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate.
| Compound Name | [5-carboxyoxy-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70265372 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [5-carboxyoxy-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate |
| SMILES | C=C(CCC=C(C)CCC=C(C)CCC=C(C)C)C1OC(OC(=O)O)C(OC(=O)O)O1 |
| InChI | InChI=1S/C23H34O8/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19-28-20(30-22(24)25)21(29-19)31-23(26)27/h9,11,13,19-21H,5-8,10,12,14H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | QCIYOWKONNFNRK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|