C30H39F3O3 — CID 46848864
[(1S,4aR,6S,8aS)-4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 46848864) has the molecular formula C30H39F3O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is [(1S,4aR,6S,8aS)-4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,4aR,6S,8aS)-4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 46848864 |
| Molecular Formula | C30H39F3O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | [(1S,4aR,6S,8aS)-4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C(CCC=C(C)C)[C@H]1CC[C@]2(C)[C@@H](OC(=O)[C@](OC)(c3ccccc3)C(F)(F)F)CC=C(C)[C@H]2C1 |
| InChI | InChI=1S/C30H39F3O3/c1-20(2)11-10-12-21(3)23-17-18-28(5)25(19-23)22(4)15-16-26(28)36-27(34)29(35-6,30(31,32)33)24-13-8-7-9-14-24/h7-9,11,13-15,23,25-26H,3,10,12,16-19H2,1-2,4-6H3/t23-,25+,26-,28-,29+/m0/s1 |
| InChIKey | RYXHNTHBDWRTIA-SBVKIAIPSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|