C23H29F3O3 — CID 102158556
[(2R,4aR)-1,4a-dimethyl-2,3,4,5,6,7,8,9-octahydrobenzo[7]annulen-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 102158556) has the molecular formula C23H29F3O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is [(2R,4aR)-1,4a-dimethyl-2,3,4,5,6,7,8,9-octahydrobenzo[7]annulen-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R,4aR)-1,4a-dimethyl-2,3,4,5,6,7,8,9-octahydrobenzo[7]annulen-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 102158556 |
| Molecular Formula | C23H29F3O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(2R,4aR)-1,4a-dimethyl-2,3,4,5,6,7,8,9-octahydrobenzo[7]annulen-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H]1CC[C@@]2(C)CCCCCC2=C1C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H29F3O3/c1-16-18-12-8-5-9-14-21(18,2)15-13-19(16)29-20(27)22(28-3,23(24,25)26)17-10-6-4-7-11-17/h4,6-7,10-11,19H,5,8-9,12-15H2,1-3H3/t19-,21-,22+/m1/s1 |
| InChIKey | ZRGDAOYXLLSFFG-FCEUIQTBSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|