C32H34F6O9 — CID 11534843
[(4R,6S,12S)-12-methyl-2,5-dioxo-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-oxacyclododec-6-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11534843) has the molecular formula C32H34F6O9 and a molecular weight of 676.60 g/mol. Its IUPAC name is [(4R,6S,12S)-12-methyl-2,5-dioxo-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-oxacyclododec-6-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4R,6S,12S)-12-methyl-2,5-dioxo-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-oxacyclododec-6-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11534843 |
| Molecular Formula | C32H34F6O9 |
| Molecular Weight | 676.60 g/mol |
| Exact Mass | 676.21 |
| IUPAC Name | [(4R,6S,12S)-12-methyl-2,5-dioxo-4-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-oxacyclododec-6-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H]1CCCCC[C@H](C)OC(=O)C[C@@H](OC(=O)[C@](OC)(c2ccccc2)C(F)(F)F)C1=O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H34F6O9/c1-20-13-7-4-12-18-23(46-27(41)29(43-2,31(33,34)35)21-14-8-5-9-15-21)26(40)24(19-25(39)45-20)47-28(42)30(44-3,32(36,37)38)22-16-10-6-11-17-22/h5-6,8-11,14-17,20,23-24H,4,7,12-13,18-19H2,1-3H3/t20-,23-,24+,29+,30+/m0/s1 |
| InChIKey | ZDABZGMEAWCLGX-QOQRZEQQSA-N |
| XLogP | 5.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|