C22H25F3O5 — CID 53467426
[(2R,4S)-2-[(3E)-3-methylhexa-3,5-dienyl]-6-oxooxan-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 53467426) has the molecular formula C22H25F3O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is [(2R,4S)-2-[(3E)-3-methylhexa-3,5-dienyl]-6-oxooxan-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R,4S)-2-[(3E)-3-methylhexa-3,5-dienyl]-6-oxooxan-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 53467426 |
| Molecular Formula | C22H25F3O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(2R,4S)-2-[(3E)-3-methylhexa-3,5-dienyl]-6-oxooxan-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C/C=C(\C)CC[C@@H]1C[C@H](OC(=O)[C@@](OC)(c2ccccc2)C(F)(F)F)CC(=O)O1 |
| InChI | InChI=1S/C22H25F3O5/c1-4-8-15(2)11-12-17-13-18(14-19(26)29-17)30-20(27)21(28-3,22(23,24)25)16-9-6-5-7-10-16/h4-10,17-18H,1,11-14H2,2-3H3/b15-8+/t17-,18+,21+/m1/s1 |
| InChIKey | KKJMEIYNPQYBOP-LHBGHSHUSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|