C29H47F3O5Si2 — CID 10507613
[(1S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10507613) has the molecular formula C29H47F3O5Si2 and a molecular weight of 588.86 g/mol. Its IUPAC name is [(1S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10507613 |
| Molecular Formula | C29H47F3O5Si2 |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [(1S,3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1[C@@H](OC(=O)[C@@](OC)(c2ccccc2)C(F)(F)F)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H47F3O5Si2/c1-20-23(35-25(33)28(34-8,29(30,31)32)21-16-14-13-15-17-21)18-22(36-38(9,10)26(2,3)4)19-24(20)37-39(11,12)27(5,6)7/h13-17,22-24H,1,18-19H2,2-12H3/t22-,23+,24+,28+/m1/s1 |
| InChIKey | AUMUBKLTZGTCCW-DELVEFKNSA-N |
| XLogP | 8.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|