C24H26F3NO4 — CID 10026713
[1-(4-acetylphenyl)azepan-4-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10026713) has the molecular formula C24H26F3NO4 and a molecular weight of 449.47 g/mol. Its IUPAC name is [1-(4-acetylphenyl)azepan-4-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [1-(4-acetylphenyl)azepan-4-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10026713 |
| Molecular Formula | C24H26F3NO4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [1-(4-acetylphenyl)azepan-4-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OC1CCCN(c2ccc(C(C)=O)cc2)CC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H26F3NO4/c1-17(29)18-10-12-20(13-11-18)28-15-6-9-21(14-16-28)32-22(30)23(31-2,24(25,26)27)19-7-4-3-5-8-19/h3-5,7-8,10-13,21H,6,9,14-16H2,1-2H3 |
| InChIKey | ALCVJPIUGCXFOC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |