C16H23NO2 — CID 174723851
(1-phenylpiperidin-4-yl) 2,2-dimethylpropanoate (PubChem CID 174723851) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (1-phenylpiperidin-4-yl) 2,2-dimethylpropanoate.
| Compound Name | (1-phenylpiperidin-4-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174723851 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1-phenylpiperidin-4-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,3)15(18)19-14-9-11-17(12-10-14)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | NWLBLXKZZHMYRG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |