C16H23BrN2O2 — CID 174721533
[1-(3-bromophenyl)piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 174721533) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is [1-(3-bromophenyl)piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-(3-bromophenyl)piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174721533 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [1-(3-bromophenyl)piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-16(2,3)18-15(20)21-14-7-9-19(10-8-14)13-6-4-5-12(17)11-13/h4-6,11,14H,7-10H2,1-3H3,(H,18,20) |
| InChIKey | OKWGAOXJTKINRC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |