C16H24ClN5O3 — CID 174640244
[1-[6-chloro-4-(hydrazinecarbonyl)-2-pyridinyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 174640244) has the molecular formula C16H24ClN5O3 and a molecular weight of 369.85 g/mol. Its IUPAC name is [1-[6-chloro-4-(hydrazinecarbonyl)-2-pyridinyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[6-chloro-4-(hydrazinecarbonyl)-2-pyridinyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174640244 |
| Molecular Formula | C16H24ClN5O3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [1-[6-chloro-4-(hydrazinecarbonyl)-2-pyridinyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(c2cc(C(=O)NN)cc(Cl)n2)CC1 |
| InChI | InChI=1S/C16H24ClN5O3/c1-16(2,3)20-15(24)25-11-4-6-22(7-5-11)13-9-10(14(23)21-18)8-12(17)19-13/h8-9,11H,4-7,18H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | YIGYVDWPKDHUCX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|