C14H21ClN4O2 — CID 174432844
[1-(2-chloropyrimidin-4-yl)piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 174432844) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is [1-(2-chloropyrimidin-4-yl)piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-(2-chloropyrimidin-4-yl)piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174432844 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [1-(2-chloropyrimidin-4-yl)piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(c2ccnc(Cl)n2)CC1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-14(2,3)18-13(20)21-10-5-8-19(9-6-10)11-4-7-16-12(15)17-11/h4,7,10H,5-6,8-9H2,1-3H3,(H,18,20) |
| InChIKey | GKHBOHCFMRLKMD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |