C19H29N3O2 — CID 174973716
[1-[3-(2-aminocyclopropyl)phenyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 174973716) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is [1-[3-(2-aminocyclopropyl)phenyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[3-(2-aminocyclopropyl)phenyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174973716 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | [1-[3-(2-aminocyclopropyl)phenyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(c2cccc(C3CC3N)c2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-19(2,3)21-18(23)24-15-7-9-22(10-8-15)14-6-4-5-13(11-14)16-12-17(16)20/h4-6,11,15-17H,7-10,12,20H2,1-3H3,(H,21,23) |
| InChIKey | VZQSKFBQZYWYRF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |