C18H30N4O2 — CID 170167658
[1-[[3-amino-2-(methylamino)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 170167658) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is [1-[[3-amino-2-(methylamino)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[[3-amino-2-(methylamino)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170167658 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | [1-[[3-amino-2-(methylamino)phenyl]methyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CNc1c(N)cccc1CN1CCC(OC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30N4O2/c1-18(2,3)21-17(23)24-14-8-10-22(11-9-14)12-13-6-5-7-15(19)16(13)20-4/h5-7,14,20H,8-12,19H2,1-4H3,(H,21,23) |
| InChIKey | WKMHVGUMOCCCNM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|