C12H24N2O3 — CID 175304424
(1-ethoxypiperidin-4-yl) N-tert-butylcarbamate (PubChem CID 175304424) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1-ethoxypiperidin-4-yl) N-tert-butylcarbamate.
| Compound Name | (1-ethoxypiperidin-4-yl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175304424 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1-ethoxypiperidin-4-yl) N-tert-butylcarbamate |
| SMILES | CCON1CCC(OC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O3/c1-5-16-14-8-6-10(7-9-14)17-11(15)13-12(2,3)4/h10H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | VYCHFKHBPNLBGL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |