C10H21N3O2 — CID 175379340
[(4R)-1-methyldiazinan-4-yl] N-tert-butylcarbamate (PubChem CID 175379340) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is [(4R)-1-methyldiazinan-4-yl] N-tert-butylcarbamate.
| Compound Name | [(4R)-1-methyldiazinan-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175379340 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | [(4R)-1-methyldiazinan-4-yl] N-tert-butylcarbamate |
| SMILES | CN1CC[C@@H](OC(=O)NC(C)(C)C)CN1 |
| InChI | InChI=1S/C10H21N3O2/c1-10(2,3)12-9(14)15-8-5-6-13(4)11-7-8/h8,11H,5-7H2,1-4H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | LWOCWWFBIFPPBG-MRVPVSSYSA-N |
| XLogP | 0.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |