C13H25ClN2O2 — CID 154699047
(8-amino-3-bicyclo[3.2.1]octanyl) N-tert-butylcarbamate;hydrochloride (PubChem CID 154699047) has the molecular formula C13H25ClN2O2 and a molecular weight of 276.81 g/mol. Its IUPAC name is (8-amino-3-bicyclo[3.2.1]octanyl) N-tert-butylcarbamate;hydrochloride.
| Compound Name | (8-amino-3-bicyclo[3.2.1]octanyl) N-tert-butylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 154699047 |
| Molecular Formula | C13H25ClN2O2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (8-amino-3-bicyclo[3.2.1]octanyl) N-tert-butylcarbamate;hydrochloride |
| SMILES | CC(C)(C)NC(=O)OC1CC2CCC(C1)C2N.Cl |
| InChI | InChI=1S/C13H24N2O2.ClH/c1-13(2,3)15-12(16)17-10-6-8-4-5-9(7-10)11(8)14;/h8-11H,4-7,14H2,1-3H3,(H,15,16);1H |
| InChIKey | MBUHIHFCOBOSTD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |