About [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate
[3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate (PubChem CID 90910799) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate |
| PubChem CID | 90910799 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCCC(CO)C1 |
| InChI | InChI=1S/C12H23NO3/c1-12(2,3)13-11(15)16-10-6-4-5-9(7-10)8-14/h9-10,14H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | XFOROQCRHKVTGW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate?
The IUPAC name of [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate (CID 90910799) is [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate.
What is the SMILES notation for [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate?
The canonical SMILES for [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCCC(CO)C1.
What is the InChIKey of [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate?
The InChIKey is XFOROQCRHKVTGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-12(2,3)13-11(15)16-10-6-4-5-9(7-10)8-14/h9-10,14H,4-8H2,1-3H3,(H,13,15).
What are the key properties of [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate?
[3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate has a molecular weight of 229.32 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)cyclohexyl] N-tert-butylcarbamate is sourced from PubChem (CID 90910799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).