About (1-methyldiazinan-4-yl) carbamate
(1-methyldiazinan-4-yl) carbamate (PubChem CID 175379398) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is (1-methyldiazinan-4-yl) carbamate.
Molecular Properties
| Compound Name | (1-methyldiazinan-4-yl) carbamate |
| PubChem CID | 175379398 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (1-methyldiazinan-4-yl) carbamate |
| SMILES | CN1CCC(OC(N)=O)CN1 |
| InChI | InChI=1S/C6H13N3O2/c1-9-3-2-5(4-8-9)11-6(7)10/h5,8H,2-4H2,1H3,(H2,7,10) |
| InChIKey | QNZCDNCLOFEFKP-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyldiazinan-4-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyldiazinan-4-yl) carbamate?
The IUPAC name of (1-methyldiazinan-4-yl) carbamate (CID 175379398) is (1-methyldiazinan-4-yl) carbamate.
What is the SMILES notation for (1-methyldiazinan-4-yl) carbamate?
The canonical SMILES for (1-methyldiazinan-4-yl) carbamate is CN1CCC(OC(N)=O)CN1.
What is the InChIKey of (1-methyldiazinan-4-yl) carbamate?
The InChIKey is QNZCDNCLOFEFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2/c1-9-3-2-5(4-8-9)11-6(7)10/h5,8H,2-4H2,1H3,(H2,7,10).
What are the key properties of (1-methyldiazinan-4-yl) carbamate?
(1-methyldiazinan-4-yl) carbamate has a molecular weight of 159.19 g/mol, XLogP of -0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyldiazinan-4-yl) carbamate is sourced from PubChem (CID 175379398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).