C14H19ClN2O2 — CID 91291495
[1-[(2-chlorophenyl)methyl]piperidin-4-yl] N-methylcarbamate (PubChem CID 91291495) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]piperidin-4-yl] N-methylcarbamate.
| Compound Name | [1-[(2-chlorophenyl)methyl]piperidin-4-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 91291495 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]piperidin-4-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-16-14(18)19-12-6-8-17(9-7-12)10-11-4-2-3-5-13(11)15/h2-5,12H,6-10H2,1H3,(H,16,18) |
| InChIKey | JXQCKQFSRYKZAL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |