C27H30N2O2 — CID 10693138
(1-benzylpiperidin-4-yl) N-(1,1-diphenylethyl)carbamate (PubChem CID 10693138) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) N-(1,1-diphenylethyl)carbamate.
| Compound Name | (1-benzylpiperidin-4-yl) N-(1,1-diphenylethyl)carbamate |
|---|---|
| PubChem CID | 10693138 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (1-benzylpiperidin-4-yl) N-(1,1-diphenylethyl)carbamate |
| SMILES | CC(NC(=O)OC1CCN(Cc2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O2/c1-27(23-13-7-3-8-14-23,24-15-9-4-10-16-24)28-26(30)31-25-17-19-29(20-18-25)21-22-11-5-2-6-12-22/h2-16,25H,17-21H2,1H3,(H,28,30) |
| InChIKey | SRHOGAXGXSKNSY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |