About (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate
(1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate (PubChem CID 21352739) has the molecular formula C27H29N3O4
and a molecular weight of 459.55 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate |
| PubChem CID | 21352739 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)OC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-33-22-13-11-21(12-14-22)26(31)28-24-9-5-6-10-25(24)29-27(32)34-23-15-17-30(18-16-23)19-20-7-3-2-4-8-20/h2-14,23H,15-19H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | YZXWGMZUZJYYQF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate?
The IUPAC name of (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate (CID 21352739) is (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate?
The canonical SMILES for (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate is COc1ccc(C(=O)Nc2ccccc2NC(=O)OC2CCN(Cc3ccccc3)CC2)cc1.
What is the InChIKey of (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate?
The InChIKey is YZXWGMZUZJYYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O4/c1-33-22-13-11-21(12-14-22)26(31)28-24-9-5-6-10-25(24)29-27(32)34-23-15-17-30(18-16-23)19-20-7-3-2-4-8-20/h2-14,23H,15-19H2,1H3,(H,28,31)(H,29,32).
What are the key properties of (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate?
(1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate has a molecular weight of 459.55 g/mol, XLogP of 5.16, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate is sourced from PubChem (CID 21352739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).