About (1-benzylpiperidin-4-yl) 2-methylbenzoate
(1-benzylpiperidin-4-yl) 2-methylbenzoate (PubChem CID 18919792) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) 2-methylbenzoate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) 2-methylbenzoate |
| PubChem CID | 18919792 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (1-benzylpiperidin-4-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23NO2/c1-16-7-5-6-10-19(16)20(22)23-18-11-13-21(14-12-18)15-17-8-3-2-4-9-17/h2-10,18H,11-15H2,1H3 |
| InChIKey | GDNXDNVQWZGEMK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzylpiperidin-4-yl) 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) 2-methylbenzoate?
The IUPAC name of (1-benzylpiperidin-4-yl) 2-methylbenzoate (CID 18919792) is (1-benzylpiperidin-4-yl) 2-methylbenzoate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) 2-methylbenzoate?
The canonical SMILES for (1-benzylpiperidin-4-yl) 2-methylbenzoate is Cc1ccccc1C(=O)OC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzylpiperidin-4-yl) 2-methylbenzoate?
The InChIKey is GDNXDNVQWZGEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2/c1-16-7-5-6-10-19(16)20(22)23-18-11-13-21(14-12-18)15-17-8-3-2-4-9-17/h2-10,18H,11-15H2,1H3.
What are the key properties of (1-benzylpiperidin-4-yl) 2-methylbenzoate?
(1-benzylpiperidin-4-yl) 2-methylbenzoate has a molecular weight of 309.41 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) 2-methylbenzoate is sourced from PubChem (CID 18919792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).