About (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride
(1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride (PubChem CID 18919861) has the molecular formula C19H21ClINO2
and a molecular weight of 457.74 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride |
| PubChem CID | 18919861 |
| Molecular Formula | C19H21ClINO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride |
| SMILES | Cl.O=C(OC1CCN(Cc2ccccc2)CC1)c1cccc(I)c1 |
| InChI | InChI=1S/C19H20INO2.ClH/c20-17-8-4-7-16(13-17)19(22)23-18-9-11-21(12-10-18)14-15-5-2-1-3-6-15;/h1-8,13,18H,9-12,14H2;1H |
| InChIKey | SUWMWNNHXFHCLT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride?
The IUPAC name of (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride (CID 18919861) is (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride.
What is the SMILES notation for (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride?
The canonical SMILES for (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride is Cl.O=C(OC1CCN(Cc2ccccc2)CC1)c1cccc(I)c1.
What is the InChIKey of (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride?
The InChIKey is SUWMWNNHXFHCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20INO2.ClH/c20-17-8-4-7-16(13-17)19(22)23-18-9-11-21(12-10-18)14-15-5-2-1-3-6-15;/h1-8,13,18H,9-12,14H2;1H.
What are the key properties of (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride?
(1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride has a molecular weight of 457.74 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) 3-iodobenzoate;hydrochloride is sourced from PubChem (CID 18919861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).