C38H30F6O6 — CID 23258223
[(8R,9S)-8-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8,9,10,11-tetrahydrobenzo[a]anthracen-9-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23258223) has the molecular formula C38H30F6O6 and a molecular weight of 696.64 g/mol. Its IUPAC name is [(8R,9S)-8-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8,9,10,11-tetrahydrobenzo[a]anthracen-9-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(8R,9S)-8-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8,9,10,11-tetrahydrobenzo[a]anthracen-9-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23258223 |
| Molecular Formula | C38H30F6O6 |
| Molecular Weight | 696.64 g/mol |
| Exact Mass | 696.19 |
| IUPAC Name | [(8R,9S)-8-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-8,9,10,11-tetrahydrobenzo[a]anthracen-9-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H]1CCc2cc3c(ccc4ccccc43)cc2[C@H]1OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H30F6O6/c1-47-35(37(39,40)41,26-12-5-3-6-13-26)33(45)49-31-20-19-25-21-29-24(18-17-23-11-9-10-16-28(23)29)22-30(25)32(31)50-34(46)36(48-2,38(42,43)44)27-14-7-4-8-15-27/h3-18,21-22,31-32H,19-20H2,1-2H3/t31-,32+,35-,36-/m0/s1 |
| InChIKey | DOTGXDPTADVBAU-KDDXCEFCSA-N |
| XLogP | 8.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.64 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|