C27H25F3O5 — CID 23244460
[(1R,2R)-2-methoxy-6,9-dimethyl-4-oxo-2,3-dihydro-1H-phenanthren-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23244460) has the molecular formula C27H25F3O5 and a molecular weight of 486.49 g/mol. Its IUPAC name is [(1R,2R)-2-methoxy-6,9-dimethyl-4-oxo-2,3-dihydro-1H-phenanthren-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,2R)-2-methoxy-6,9-dimethyl-4-oxo-2,3-dihydro-1H-phenanthren-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23244460 |
| Molecular Formula | C27H25F3O5 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [(1R,2R)-2-methoxy-6,9-dimethyl-4-oxo-2,3-dihydro-1H-phenanthren-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@H]1CC(=O)c2c(cc(C)c3ccc(C)cc23)[C@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H25F3O5/c1-15-10-11-18-16(2)13-20-23(19(18)12-15)21(31)14-22(33-3)24(20)35-25(32)26(34-4,27(28,29)30)17-8-6-5-7-9-17/h5-13,22,24H,14H2,1-4H3/t22-,24-,26-/m1/s1 |
| InChIKey | OGAQWGLIJMPPBH-QIGHUWCUSA-N |
| XLogP | 5.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |